Ectoine CAS#96702-03-3
Ectoine is a naturally occurring osmoprotectant, a cyclic amino acid derivative that offers exceptional cell-stabilizing properties. Highly valued in cosmetics and pharmaceuticals, it enhances product efficacy by maintaining cell integrity under various environmental stresses.
| Ectoine Chemical Properties |
| Melting point | ~280?? |
| alpha | D20 +140?? (c = 1.0 in methanol) |
| Boiling point | 381.5??35.0 ??C(Predicted) |
| density | 1.37 |
| storage temp. | 2-8??C |
| solubility | methanol: 20?mg/mL, clear, colorless |
| pka | 3.14??0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Water : 250 mg/mL (1758.58 mM) |
| BRN | 7288977 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H10N2O2/c1-4-7-3-2-5(8-4)6(9)10/h5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChIKey | WQXNXVUDBPYKBA-YFKPBYRVSA-N |
| SMILES | C1(C)=NCC[C@@H](C(O)=O)N1 |
Related Products
Chemical Name: Choline salicylate
CAS No.: 2016-36-6
Molecular Formula: C12H19NO4
Molecular Weight: 241.28
Appearance: Red-Brown Crystal
Octocrylene is an organic compound widely recognized for its potent UV-filtering properties, making it an essential ingredient in sunscreens and other skincare products designed to protect the skin from harmful ultraviolet radiation. With the chemical name 2-(4-Methylbenzyl)-2H-benzotriazole-5-methyl, octocrylene is a stable and photostable molecule that provides broad-spectrum protection against both UVA and UVB rays.
This oil-soluble chemical is valued for its ability to absorb UV radiation effectively, converting it into heat without causing skin irritation or staining clothes. Octocrylene is often used in combination with other UV filters to enhance the sun protection factor (SPF) of formulations, ensuring a balanced and comprehensive defense against sun damage.
As a lipophilic compound, octocrylene is compatible with various cosmetic and dermatological formulations, contributing to the development of lightweight, non-greasy sunscreens. Its chemical structure allows for a high degree of safety and efficacy, making it suitable for a wide range of skin types, including sensitive skin.
In summary, octocrylene is a reliable and efficient UV filter, pivotal in the formulation of modern sunscreens that offer advanced protection against the sun’s harmful effects while maintaining skin comfort and product aesthetics.
N,N-Dimethylaniline is an organic compound with amine and methyl groups attached to a benzene ring. It is a colorless liquid with a characteristic amine odor. This compound is primarily used as a chemical intermediate in the synthesis of dyes, pigments, and polymers. Its reactivity makes it a valuable building block in the production of various organic compounds, particularly in the pharmaceutical and chemical industries.
Common English name: 5-iodo-2,3-dihydropyridazin-3-one
CAS No.: 825633-94-1
Molecular formula: C4H3IN2O
Molecular weight: 221.98
Sample: Available
Chemical Name: Imazalil Sulfate
CAS No.: 58594-72-2
Molecular Formula: C14H14Cl2N2O.H2SO4
Molecular Weight: 395.26
Appearance: Solid
Benzothiazoles are a class of chemical compounds characterized by a fused benzene and thiazole ring. They exhibit a broad spectrum of applications, particularly as antioxidants in rubber and plastic industries, enhancing product longevity and performance. Additionally, benzothiazoles serve as key intermediates in the synthesis of pharmaceuticals, contributing to the development of life-saving drugs. Recognized for their stability and reactivity, these compounds are integral to advancing material science and healthcare solutions.
Chemical Name: STODDARD SOLVENT
CAS No.: 64742-88-7
Appearance: Colorless or Light Yellow Liquid
Chemical Name: o-Xylene
Synonyms: 1,2-Dimethylbenzene; ortho-xylene
CAS No.: 95-47-6
Molecular Formula: C8H10
Molecular Weight: 106.17
Chemical Name: Dehydrocholic acid
Synonyms: Acide dehydrocholique; Triketocholanic acid
CAS No.: 81-23-2
Molecular Formula: C24H34O5
Molecular Weight: 402.53
Appearance: Powder
Tetraacetylethylenediamine is a fully acetylated derivative of ethylenediamine, offering a high reactivity as an intermediate in organic synthesis. Its unique structure makes it a critical component in the production of specialty chemicals and pharmaceuticals, ensuring a wide range of applications in the chemical industry.
Silicones are a family of synthetic polymers known for their versatility and stability. They are heat-resistant, non-toxic, and have excellent electrical insulation properties. Commonly used in various industries such as construction, automotive, aerospace, and personal care products, silicones offer a wide range of applications from sealants and adhesives to lubricants and medical devices. Their resistance to extreme temperatures and weathering makes them a preferred choice for many high-performance applications.
Chemical Name: Quercetin-3-O-sophoroside
CAS No.: 18609-17-1
Molecular Formula: C27H30O17
Molecular Weight: 626.52
